C20H13NO5 — CID 101002428
8-(1,3-benzodioxol-5-yl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,7,9,11(15)-pentaen-6-one (PubChem CID 101002428) has the molecular formula C20H13NO5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-yl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,7,9,11(15)-pentaen-6-one.
| Compound Name | 8-(1,3-benzodioxol-5-yl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,7,9,11(15)-pentaen-6-one |
|---|---|
| PubChem CID | 101002428 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 8-(1,3-benzodioxol-5-yl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,7,9,11(15)-pentaen-6-one |
| SMILES | O=C1CCc2nc3cc4c(cc3c(-c3ccc5c(c3)OCO5)c21)OCO4 |
| InChI | InChI=1S/C20H13NO5/c22-14-3-2-12-20(14)19(10-1-4-15-16(5-10)24-8-23-15)11-6-17-18(26-9-25-17)7-13(11)21-12/h1,4-7H,2-3,8-9H2 |
| InChIKey | JRUVEWPXSOORLW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |