C9H17F2O4P — CID 101002673
[(1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopropyl]methanol (PubChem CID 101002673) has the molecular formula C9H17F2O4P and a molecular weight of 258.20 g/mol. Its IUPAC name is [(1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 101002673 |
| Molecular Formula | C9H17F2O4P |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [(1R,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclopropyl]methanol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1C[C@H]1CO |
| InChI | InChI=1S/C9H17F2O4P/c1-3-14-16(13,15-4-2)9(10,11)8-5-7(8)6-12/h7-8,12H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | RSVVLNHQAURKLG-YUMQZZPRSA-N |
| XLogP | 2.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|