C9H12N4O4 — CID 101003040
(1S,9S,10S,11R)-10,11-dihydroxy-12-oxa-2,5,7-triazatricyclo[7.2.1.03,7]dodeca-3,5-diene-4-carboxamide (PubChem CID 101003040) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is (1S,9S,10S,11R)-10,11-dihydroxy-12-oxa-2,5,7-triazatricyclo[7.2.1.03,7]dodeca-3,5-diene-4-carboxamide.
| Compound Name | (1S,9S,10S,11R)-10,11-dihydroxy-12-oxa-2,5,7-triazatricyclo[7.2.1.03,7]dodeca-3,5-diene-4-carboxamide |
|---|---|
| PubChem CID | 101003040 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (1S,9S,10S,11R)-10,11-dihydroxy-12-oxa-2,5,7-triazatricyclo[7.2.1.03,7]dodeca-3,5-diene-4-carboxamide |
| SMILES | NC(=O)c1ncn2c1N[C@H]1O[C@@H](C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H12N4O4/c10-7(16)4-8-12-9-6(15)5(14)3(17-9)1-13(8)2-11-4/h2-3,5-6,9,12,14-15H,1H2,(H2,10,16)/t3-,5+,6+,9-/m0/s1 |
| InChIKey | RHPHUJAABITDDU-PXMDKTAGSA-N |
| XLogP | -2.15 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |