C8H12O2 — CID 101003541
(5Z)-5-methyl-2,3,4,7-tetrahydrooxocin-8-one (PubChem CID 101003541) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (5Z)-5-methyl-2,3,4,7-tetrahydrooxocin-8-one.
| Compound Name | (5Z)-5-methyl-2,3,4,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 101003541 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (5Z)-5-methyl-2,3,4,7-tetrahydrooxocin-8-one |
| SMILES | C/C1=C/CC(=O)OCCC1 |
| InChI | InChI=1S/C8H12O2/c1-7-3-2-6-10-8(9)5-4-7/h4H,2-3,5-6H2,1H3/b7-4- |
| InChIKey | FONXFTMLNZCKAG-DAXSKMNVSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|