C35H35NO2P2 — CID 101003824
(1S,2R)-N-diphenylphosphanyl-1-[(2-methoxyphenyl)-phenylphosphanyl]oxy-N-methyl-1-phenylpropan-2-amine (PubChem CID 101003824) has the molecular formula C35H35NO2P2 and a molecular weight of 563.62 g/mol. Its IUPAC name is (1S,2R)-N-diphenylphosphanyl-1-[(2-methoxyphenyl)-phenylphosphanyl]oxy-N-methyl-1-phenylpropan-2-amine.
| Compound Name | (1S,2R)-N-diphenylphosphanyl-1-[(2-methoxyphenyl)-phenylphosphanyl]oxy-N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 101003824 |
| Molecular Formula | C35H35NO2P2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (1S,2R)-N-diphenylphosphanyl-1-[(2-methoxyphenyl)-phenylphosphanyl]oxy-N-methyl-1-phenylpropan-2-amine |
| SMILES | COc1ccccc1P(O[C@@H](c1ccccc1)[C@@H](C)N(C)P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H35NO2P2/c1-28(36(2)39(30-20-10-5-11-21-30)31-22-12-6-13-23-31)35(29-18-8-4-9-19-29)38-40(32-24-14-7-15-25-32)34-27-17-16-26-33(34)37-3/h4-28,35H,1-3H3/t28-,35-,40?/m1/s1 |
| InChIKey | JXAYVRVBHGLNQQ-YYEJIOGFSA-N |
| XLogP | 7.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|