C21H44O5Si2 — CID 101003948
methyl (4R,5S,6S)-4,6-dimethyl-8-oxo-4,5-bis(2-trimethylsilylethoxy)octanoate (PubChem CID 101003948) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is methyl (4R,5S,6S)-4,6-dimethyl-8-oxo-4,5-bis(2-trimethylsilylethoxy)octanoate.
| Compound Name | methyl (4R,5S,6S)-4,6-dimethyl-8-oxo-4,5-bis(2-trimethylsilylethoxy)octanoate |
|---|---|
| PubChem CID | 101003948 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | methyl (4R,5S,6S)-4,6-dimethyl-8-oxo-4,5-bis(2-trimethylsilylethoxy)octanoate |
| SMILES | COC(=O)CC[C@@](C)(OCC[Si](C)(C)C)[C@@H](OCC[Si](C)(C)C)[C@@H](C)CC=O |
| InChI | InChI=1S/C21H44O5Si2/c1-18(11-13-22)20(25-14-16-27(4,5)6)21(2,12-10-19(23)24-3)26-15-17-28(7,8)9/h13,18,20H,10-12,14-17H2,1-9H3/t18-,20-,21+/m0/s1 |
| InChIKey | LFSNOBQGVFQJAH-SESVDKBCSA-N |
| XLogP | 5.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|