C56H52 — CID 101004068
4-[(5R,7S)-3-[4-[4-[(5S,7R)-3-naphthalen-2-yl-1-adamantyl]phenyl]phenyl]-1-adamantyl]phenanthrene (PubChem CID 101004068) has the molecular formula C56H52 and a molecular weight of 725.03 g/mol. Its IUPAC name is 4-[(5R,7S)-3-[4-[4-[(5S,7R)-3-naphthalen-2-yl-1-adamantyl]phenyl]phenyl]-1-adamantyl]phenanthrene.
| Compound Name | 4-[(5R,7S)-3-[4-[4-[(5S,7R)-3-naphthalen-2-yl-1-adamantyl]phenyl]phenyl]-1-adamantyl]phenanthrene |
|---|---|
| PubChem CID | 101004068 |
| Molecular Formula | C56H52 |
| Molecular Weight | 725.03 g/mol |
| Exact Mass | 724.41 |
| IUPAC Name | 4-[(5R,7S)-3-[4-[4-[(5S,7R)-3-naphthalen-2-yl-1-adamantyl]phenyl]phenyl]-1-adamantyl]phenanthrene |
| SMILES | c1ccc2cc(C34C[C@@H]5C[C@@H](CC(c6ccc(-c7ccc(C89C[C@H]%10C[C@@H](C8)CC(c8cccc%11ccc%12ccccc%12c8%11)(C%10)C9)cc7)cc6)(C5)C3)C4)ccc2c1 |
| InChI | InChI=1S/C56H52/c1-2-8-46-26-49(23-18-41(46)6-1)55-31-37-24-38(32-55)28-53(27-37,35-55)47-19-14-42(15-20-47)43-16-21-48(22-17-43)54-29-39-25-40(30-54)34-56(33-39,36-54)51-11-5-9-45-13-12-44-7-3-4-10-50(44)52(45)51/h1-23,26,37-40H,24-25,27-36H2/t37-,38+,39-,40+,53?,54?,55?,56? |
| InChIKey | KMFDGOQCXCANHK-QPHZETOOSA-N |
| XLogP | 14.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.03 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|