C34H52N4O5S — CID 101004278
(2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N'-[2-(dimethylamino)-2-oxoethyl]-N'-[(1S)-1-phenylethyl]-2-(1,3-thiazol-4-ylmethyl)butanediamide (PubChem CID 101004278) has the molecular formula C34H52N4O5S and a molecular weight of 628.88 g/mol. Its IUPAC name is (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N'-[2-(dimethylamino)-2-oxoethyl]-N'-[(1S)-1-phenylethyl]-2-(1,3-thiazol-4-ylmethyl)butanediamide.
| Compound Name | (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N'-[2-(dimethylamino)-2-oxoethyl]-N'-[(1S)-1-phenylethyl]-2-(1,3-thiazol-4-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 101004278 |
| Molecular Formula | C34H52N4O5S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N'-[2-(dimethylamino)-2-oxoethyl]-N'-[(1S)-1-phenylethyl]-2-(1,3-thiazol-4-ylmethyl)butanediamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC(=O)N(CC(=O)N(C)C)[C@@H](C)c1ccccc1)Cc1cscn1 |
| InChI | InChI=1S/C34H52N4O5S/c1-23(2)16-30(39)33(42)29(17-25-12-8-6-9-13-25)36-34(43)27(18-28-21-44-22-35-28)19-31(40)38(20-32(41)37(4)5)24(3)26-14-10-7-11-15-26/h7,10-11,14-15,21-25,27,29-30,33,39,42H,6,8-9,12-13,16-20H2,1-5H3,(H,36,43)/t24-,27-,29-,30-,33+/m0/s1 |
| InChIKey | OBKLHQONFGKQAE-NPDLGHHVSA-N |
| XLogP | 4.59 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |