C17H16F2N2O7 — CID 101004310
3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 101004310) has the molecular formula C17H16F2N2O7 and a molecular weight of 398.32 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101004310 |
| Molecular Formula | C17H16F2N2O7 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1c(=O)ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2N2O7/c18-8-1-2-9(10(19)5-8)11(23)6-21-13(24)3-4-20(17(21)27)16-15(26)14(25)12(7-22)28-16/h1-5,12,14-16,22,25-26H,6-7H2/t12-,14-,15-,16-/m1/s1 |
| InChIKey | QAIKACQSKNZRNU-DTZQCDIJSA-N |
| XLogP | -1.22 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |