About 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate
2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate (PubChem CID 101004436) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate.
Molecular Properties
| Compound Name | 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate |
| PubChem CID | 101004436 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate |
| SMILES | C=C[C@@H](CCC)[C@H](CC)C(=O)C(=O)OCCOC |
| InChI | InChI=1S/C14H24O4/c1-5-8-11(6-2)12(7-3)13(15)14(16)18-10-9-17-4/h6,11-12H,2,5,7-10H2,1,3-4H3/t11-,12-/m0/s1 |
| InChIKey | CZHHWHAYHBSDRH-RYUDHWBXSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate?
The IUPAC name of 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate (CID 101004436) is 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate.
What is the SMILES notation for 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate?
The canonical SMILES for 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate is C=C[C@@H](CCC)[C@H](CC)C(=O)C(=O)OCCOC.
What is the InChIKey of 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate?
The InChIKey is CZHHWHAYHBSDRH-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H24O4/c1-5-8-11(6-2)12(7-3)13(15)14(16)18-10-9-17-4/h6,11-12H,2,5,7-10H2,1,3-4H3/t11-,12-/m0/s1.
What are the key properties of 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate?
2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate has a molecular weight of 256.34 g/mol, XLogP of 2.37, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (3S,4R)-4-ethenyl-3-ethyl-2-oxoheptanoate is sourced from PubChem (CID 101004436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).