About (3Z)-4-ethoxyocta-1,3-diene
(3Z)-4-ethoxyocta-1,3-diene (PubChem CID 101004520) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (3Z)-4-ethoxyocta-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-4-ethoxyocta-1,3-diene |
| PubChem CID | 101004520 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (3Z)-4-ethoxyocta-1,3-diene |
| SMILES | C=C/C=C(/CCCC)OCC |
| InChI | InChI=1S/C10H18O/c1-4-7-9-10(8-5-2)11-6-3/h5,8H,2,4,6-7,9H2,1,3H3/b10-8- |
| InChIKey | OKDAQBYMTLSARD-NTMALXAHSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-ethoxyocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-ethoxyocta-1,3-diene?
The IUPAC name of (3Z)-4-ethoxyocta-1,3-diene (CID 101004520) is (3Z)-4-ethoxyocta-1,3-diene.
What is the SMILES notation for (3Z)-4-ethoxyocta-1,3-diene?
The canonical SMILES for (3Z)-4-ethoxyocta-1,3-diene is C=C/C=C(/CCCC)OCC.
What is the InChIKey of (3Z)-4-ethoxyocta-1,3-diene?
The InChIKey is OKDAQBYMTLSARD-NTMALXAHSA-N. The full InChI is InChI=1S/C10H18O/c1-4-7-9-10(8-5-2)11-6-3/h5,8H,2,4,6-7,9H2,1,3H3/b10-8-.
What are the key properties of (3Z)-4-ethoxyocta-1,3-diene?
(3Z)-4-ethoxyocta-1,3-diene has a molecular weight of 154.25 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-ethoxyocta-1,3-diene is sourced from PubChem (CID 101004520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).