C36H30N6O3S3 — CID 101004722
(4R,11R,18R)-4,11,18-tribenzyl-6,13,20-trithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione (PubChem CID 101004722) has the molecular formula C36H30N6O3S3 and a molecular weight of 690.88 g/mol. Its IUPAC name is (4R,11R,18R)-4,11,18-tribenzyl-6,13,20-trithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione.
| Compound Name | (4R,11R,18R)-4,11,18-tribenzyl-6,13,20-trithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
|---|---|
| PubChem CID | 101004722 |
| Molecular Formula | C36H30N6O3S3 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | (4R,11R,18R)-4,11,18-tribenzyl-6,13,20-trithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
| SMILES | O=C1N[C@H](Cc2ccccc2)c2nc(cs2)C(=O)N[C@H](Cc2ccccc2)c2nc(cs2)C(=O)N[C@H](Cc2ccccc2)c2nc1cs2 |
| InChI | InChI=1S/C36H30N6O3S3/c43-31-28-20-47-35(41-28)26(17-23-12-6-2-7-13-23)39-33(45)30-21-48-36(42-30)27(18-24-14-8-3-9-15-24)38-32(44)29-19-46-34(40-29)25(37-31)16-22-10-4-1-5-11-22/h1-15,19-21,25-27H,16-18H2,(H,37,43)(H,38,44)(H,39,45)/t25-,26-,27-/m1/s1 |
| InChIKey | UOUJTFQWKXBIIX-ZONZVBGPSA-N |
| XLogP | 6.51 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |