C10H17N3O5 — CID 101005429
(2R,3S,4R,5S)-6-(pyrazin-2-ylamino)hexane-1,2,3,4,5-pentol (PubChem CID 101005429) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2R,3S,4R,5S)-6-(pyrazin-2-ylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5S)-6-(pyrazin-2-ylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 101005429 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R,3S,4R,5S)-6-(pyrazin-2-ylamino)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CNc1cnccn1 |
| InChI | InChI=1S/C10H17N3O5/c14-5-7(16)10(18)9(17)6(15)3-13-8-4-11-1-2-12-8/h1-2,4,6-7,9-10,14-18H,3,5H2,(H,12,13)/t6-,7+,9+,10-/m0/s1 |
| InChIKey | ROCRDWMMBUOHQE-WDQPUEAGSA-N |
| XLogP | -2.68 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |