C22H32O4 — CID 101006064
[(2E,10E)-3,11,15-trimethyl-7-methylidene-6,13-dioxohexadeca-2,10,14-trienyl] acetate (PubChem CID 101006064) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(2E,10E)-3,11,15-trimethyl-7-methylidene-6,13-dioxohexadeca-2,10,14-trienyl] acetate.
| Compound Name | [(2E,10E)-3,11,15-trimethyl-7-methylidene-6,13-dioxohexadeca-2,10,14-trienyl] acetate |
|---|---|
| PubChem CID | 101006064 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(2E,10E)-3,11,15-trimethyl-7-methylidene-6,13-dioxohexadeca-2,10,14-trienyl] acetate |
| SMILES | C=C(CC/C=C(\C)CC(=O)C=C(C)C)C(=O)CC/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C22H32O4/c1-16(2)14-21(24)15-18(4)8-7-9-19(5)22(25)11-10-17(3)12-13-26-20(6)23/h8,12,14H,5,7,9-11,13,15H2,1-4,6H3/b17-12+,18-8+ |
| InChIKey | NAWDPRCDXGNUNV-YDBXTPAVSA-N |
| XLogP | 5.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|