C35H52N6O5 — CID 10100616
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 10100616) has the molecular formula C35H52N6O5 and a molecular weight of 636.84 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 10100616 |
| Molecular Formula | C35H52N6O5 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@@H](N)CC(C)C)C(C)C)C(N)=O |
| InChI | InChI=1S/C35H52N6O5/c1-6-7-18-27(31(37)42)38-33(44)28(20-24-14-10-8-11-15-24)39-34(45)29(21-25-16-12-9-13-17-25)40-35(46)30(23(4)5)41-32(43)26(36)19-22(2)3/h8-17,22-23,26-30H,6-7,18-21,36H2,1-5H3,(H2,37,42)(H,38,44)(H,39,45)(H,40,46)(H,41,43)/t26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | NKFGISLTWRAGJU-IIZANFQQSA-N |
| XLogP | 2.12 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |