C18H26O3 — CID 101006799
(3R,4S,4aR)-4-[(3aS,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-3,4-dimethyl-2,3,4a,5,6,7-hexahydronaphthalen-1-one (PubChem CID 101006799) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3R,4S,4aR)-4-[(3aS,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-3,4-dimethyl-2,3,4a,5,6,7-hexahydronaphthalen-1-one.
| Compound Name | (3R,4S,4aR)-4-[(3aS,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-3,4-dimethyl-2,3,4a,5,6,7-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 101006799 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3R,4S,4aR)-4-[(3aS,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-3,4-dimethyl-2,3,4a,5,6,7-hexahydronaphthalen-1-one |
| SMILES | C[C@@H]1CC(=O)C2=CCCC[C@@H]2[C@@]1(C)[C@@H]1C[C@@H]2CCO[C@H]2O1 |
| InChI | InChI=1S/C18H26O3/c1-11-9-15(19)13-5-3-4-6-14(13)18(11,2)16-10-12-7-8-20-17(12)21-16/h5,11-12,14,16-17H,3-4,6-10H2,1-2H3/t11-,12+,14+,16+,17+,18+/m1/s1 |
| InChIKey | XFARJEKDOCGUTI-CGBHSNBESA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |