C12H8S12 — CID 101006825
2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol (PubChem CID 101006825) has the molecular formula C12H8S12 and a molecular weight of 537.00 g/mol. Its IUPAC name is 2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol.
| Compound Name | 2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
|---|---|
| PubChem CID | 101006825 |
| Molecular Formula | C12H8S12 |
| Molecular Weight | 537.00 g/mol |
| Exact Mass | 535.73 |
| IUPAC Name | 2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(SC(=C4SC(S)=C(S)S4)S3)S2)S1 |
| InChI | InChI=1S/C12H8S12/c1-15-5-6(16-2)20-9(19-5)10-23-11-12(24-10)22-8(21-11)7-17-3(13)4(14)18-7/h13-14H,1-2H3 |
| InChIKey | VCOASGWIMVDZMM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.00 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|