C22H25NO2 — CID 101007675
(3S,4R)-3-butyl-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one (PubChem CID 101007675) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (3S,4R)-3-butyl-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-butyl-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one |
|---|---|
| PubChem CID | 101007675 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (3S,4R)-3-butyl-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one |
| SMILES | CCCC[C@@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-3-4-10-20-21(16-11-17-8-6-5-7-9-17)23(22(20)24)18-12-14-19(25-2)15-13-18/h5-9,11-16,20-21H,3-4,10H2,1-2H3/b16-11+/t20-,21+/m0/s1 |
| InChIKey | IQCDAWYVRNCDCN-DJRZKHRSSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |