C20H25NO2 — CID 101007844
(3R,4R)-3-[(1E)-buta-1,3-dienyl]-1-cyclohexyl-4-(4-methoxyphenyl)azetidin-2-one (PubChem CID 101007844) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (3R,4R)-3-[(1E)-buta-1,3-dienyl]-1-cyclohexyl-4-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4R)-3-[(1E)-buta-1,3-dienyl]-1-cyclohexyl-4-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 101007844 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3R,4R)-3-[(1E)-buta-1,3-dienyl]-1-cyclohexyl-4-(4-methoxyphenyl)azetidin-2-one |
| SMILES | C=C/C=C/[C@H]1C(=O)N(C2CCCCC2)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-4-10-18-19(15-11-13-17(23-2)14-12-15)21(20(18)22)16-8-6-5-7-9-16/h3-4,10-14,16,18-19H,1,5-9H2,2H3/b10-4+/t18-,19+/m1/s1 |
| InChIKey | QKOGFQOITNCSCK-WOHURHRVSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|