C15H20OSe — CID 101007954
(2S,3aS,7aR)-2-(phenylselanylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 101007954) has the molecular formula C15H20OSe and a molecular weight of 295.28 g/mol. Its IUPAC name is (2S,3aS,7aR)-2-(phenylselanylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | (2S,3aS,7aR)-2-(phenylselanylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 101007954 |
| Molecular Formula | C15H20OSe |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (2S,3aS,7aR)-2-(phenylselanylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | c1ccc([Se]C[C@@H]2C[C@@H]3CCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C15H20OSe/c1-2-7-14(8-3-1)17-11-13-10-12-6-4-5-9-15(12)16-13/h1-3,7-8,12-13,15H,4-6,9-11H2/t12-,13-,15+/m0/s1 |
| InChIKey | MARMJCZKNUKENR-KCQAQPDRSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|