C17H15N3O6 — CID 101008202
2,8-bis(2-hydroxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde (PubChem CID 101008202) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2,8-bis(2-hydroxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde.
| Compound Name | 2,8-bis(2-hydroxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde |
|---|---|
| PubChem CID | 101008202 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2,8-bis(2-hydroxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde |
| SMILES | O=Cc1cn(CCO)c(=O)c2cc3c(=O)n(CCO)cc(C=O)c3nc12 |
| InChI | InChI=1S/C17H15N3O6/c21-3-1-19-6-10(8-23)14-12(16(19)25)5-13-15(18-14)11(9-24)7-20(2-4-22)17(13)26/h5-9,21-22H,1-4H2 |
| InChIKey | GXSZDFOMGJLTOV-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|