C17H17N5O2 — CID 101008216
2,8-dimethyl-4,6-bis(methyliminomethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 101008216) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2,8-dimethyl-4,6-bis(methyliminomethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 2,8-dimethyl-4,6-bis(methyliminomethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 101008216 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2,8-dimethyl-4,6-bis(methyliminomethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | C/N=C/c1cn(C)c(=O)c2cc3c(=O)n(C)cc(/C=N/C)c3nc12 |
| InChI | InChI=1S/C17H17N5O2/c1-18-6-10-8-21(3)16(23)12-5-13-15(20-14(10)12)11(7-19-2)9-22(4)17(13)24/h5-9H,1-4H3/b18-6+,19-7+ |
| InChIKey | XSFICQHHUGLEFG-JRGWAENISA-N |
| XLogP | 0.88 |
| TPSA | 81.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|