C38H48N4O6 — CID 10100838
5-[acetyl(phenylmethoxy)amino]-N-[5-[4-cyanobutyl(phenylmethoxy)amino]-5-oxopentyl]-N-phenylmethoxypentanamide (PubChem CID 10100838) has the molecular formula C38H48N4O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is 5-[acetyl(phenylmethoxy)amino]-N-[5-[4-cyanobutyl(phenylmethoxy)amino]-5-oxopentyl]-N-phenylmethoxypentanamide.
| Compound Name | 5-[acetyl(phenylmethoxy)amino]-N-[5-[4-cyanobutyl(phenylmethoxy)amino]-5-oxopentyl]-N-phenylmethoxypentanamide |
|---|---|
| PubChem CID | 10100838 |
| Molecular Formula | C38H48N4O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | 5-[acetyl(phenylmethoxy)amino]-N-[5-[4-cyanobutyl(phenylmethoxy)amino]-5-oxopentyl]-N-phenylmethoxypentanamide |
| SMILES | CC(=O)N(CCCCC(=O)N(CCCCC(=O)N(CCCCC#N)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H48N4O6/c1-33(43)40(46-30-34-18-6-2-7-19-34)27-16-12-24-38(45)42(48-32-36-22-10-4-11-23-36)29-17-13-25-37(44)41(28-15-5-14-26-39)47-31-35-20-8-3-9-21-35/h2-4,6-11,18-23H,5,12-17,24-25,27-32H2,1H3 |
| InChIKey | SBSARTSBVZLDAS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 112.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|