C17H28OSi — CID 101008485
(2E,6E)-4,4,7-trimethyl-11-trimethylsilylundeca-2,6-dien-10-ynal (PubChem CID 101008485) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (2E,6E)-4,4,7-trimethyl-11-trimethylsilylundeca-2,6-dien-10-ynal.
| Compound Name | (2E,6E)-4,4,7-trimethyl-11-trimethylsilylundeca-2,6-dien-10-ynal |
|---|---|
| PubChem CID | 101008485 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (2E,6E)-4,4,7-trimethyl-11-trimethylsilylundeca-2,6-dien-10-ynal |
| SMILES | C/C(=C\CC(C)(C)/C=C/C=O)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H28OSi/c1-16(10-7-8-15-19(4,5)6)11-13-17(2,3)12-9-14-18/h9,11-12,14H,7,10,13H2,1-6H3/b12-9+,16-11+ |
| InChIKey | NLFMNRZWIXTTAQ-WBJPGKSWSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|