About [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane
[(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101009001) has the molecular formula C17H33IOSi
and a molecular weight of 408.44 g/mol. Its IUPAC name is [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 101009001 |
| Molecular Formula | C17H33IOSi |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1CCC(C)(C)C=C1I)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H33IOSi/c1-12(2)20(13(3)4,14(5)6)19-16-9-10-17(7,8)11-15(16)18/h11-14,16H,9-10H2,1-8H3/t16-/m1/s1 |
| InChIKey | GPDNCZSCSUQXRE-MRXNPFEDSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane (CID 101009001) is [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane is CC(C)[Si](O[C@@H]1CCC(C)(C)C=C1I)(C(C)C)C(C)C.
What is the InChIKey of [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is GPDNCZSCSUQXRE-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H33IOSi/c1-12(2)20(13(3)4,14(5)6)19-16-9-10-17(7,8)11-15(16)18/h11-14,16H,9-10H2,1-8H3/t16-/m1/s1.
What are the key properties of [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane?
[(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 408.44 g/mol, XLogP of 6.69, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-iodo-4,4-dimethylcyclohex-2-en-1-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 101009001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).