C20H40N4S4 — CID 101009023
4,5,15,16-tetrathia-1,8,12,19-tetrazatricyclo[17.3.3.38,12]octacosane (PubChem CID 101009023) has the molecular formula C20H40N4S4 and a molecular weight of 464.84 g/mol. Its IUPAC name is 4,5,15,16-tetrathia-1,8,12,19-tetrazatricyclo[17.3.3.38,12]octacosane.
| Compound Name | 4,5,15,16-tetrathia-1,8,12,19-tetrazatricyclo[17.3.3.38,12]octacosane |
|---|---|
| PubChem CID | 101009023 |
| Molecular Formula | C20H40N4S4 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4,5,15,16-tetrathia-1,8,12,19-tetrazatricyclo[17.3.3.38,12]octacosane |
| SMILES | C1CN2CCCN(C1)CCSSCCN1CCCN(CCC1)CCSSCC2 |
| InChI | InChI=1S/C20H40N4S4/c1-5-21-7-2-8-22(6-1)14-18-26-28-20-16-24-10-3-9-23(11-4-12-24)15-19-27-25-17-13-21/h1-20H2 |
| InChIKey | OYEIIEBHWXXKIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|