About N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide
N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide (PubChem CID 10100918) has the molecular formula C14H11N3O3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide |
| PubChem CID | 10100918 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C14H11N3O3S/c18-21(19,17-12-9-5-2-6-10-12)14-16-15-13(20-14)11-7-3-1-4-8-11/h1-10,17H |
| InChIKey | CMPXKCHOYMYINM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide?
The IUPAC name of N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide (CID 10100918) is N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide.
What is the SMILES notation for N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide?
The canonical SMILES for N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide is O=S(=O)(Nc1ccccc1)c1nnc(-c2ccccc2)o1.
What is the InChIKey of N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide?
The InChIKey is CMPXKCHOYMYINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3S/c18-21(19,17-12-9-5-2-6-10-12)14-16-15-13(20-14)11-7-3-1-4-8-11/h1-10,17H.
What are the key properties of N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide?
N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide has a molecular weight of 301.33 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-diphenyl-1,3,4-oxadiazole-2-sulfonamide is sourced from PubChem (CID 10100918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).