About (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole]
(2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] (PubChem CID 101009388) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole].
Molecular Properties
| Compound Name | (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] |
| PubChem CID | 101009388 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] |
| SMILES | CN1c2ccccc2C=C[C@]12N(c1ccccc1)N=NC2(C)C |
| InChI | InChI=1S/C19H20N4/c1-18(2)19(23(21-20-18)16-10-5-4-6-11-16)14-13-15-9-7-8-12-17(15)22(19)3/h4-14H,1-3H3/t19-/m1/s1 |
| InChIKey | VIYLJPOVKPIDQX-LJQANCHMSA-N |
| XLogP | 4.51 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole]?
The IUPAC name of (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] (CID 101009388) is (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole].
What is the SMILES notation for (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole]?
The canonical SMILES for (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] is CN1c2ccccc2C=C[C@]12N(c1ccccc1)N=NC2(C)C.
What is the InChIKey of (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole]?
The InChIKey is VIYLJPOVKPIDQX-LJQANCHMSA-N. The full InChI is InChI=1S/C19H20N4/c1-18(2)19(23(21-20-18)16-10-5-4-6-11-16)14-13-15-9-7-8-12-17(15)22(19)3/h4-14H,1-3H3/t19-/m1/s1.
What are the key properties of (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole]?
(2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] has a molecular weight of 304.40 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,4',4'-trimethyl-1'-phenylspiro[quinoline-2,5'-triazole] is sourced from PubChem (CID 101009388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).