C9H17NO5 — CID 101009658
N-[(1S,2R,3S,4R,6S)-2,3,6-trihydroxy-4-(hydroxymethyl)cyclohexyl]acetamide (PubChem CID 101009658) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R,6S)-2,3,6-trihydroxy-4-(hydroxymethyl)cyclohexyl]acetamide.
| Compound Name | N-[(1S,2R,3S,4R,6S)-2,3,6-trihydroxy-4-(hydroxymethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 101009658 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(1S,2R,3S,4R,6S)-2,3,6-trihydroxy-4-(hydroxymethyl)cyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)C[C@@H]1O |
| InChI | InChI=1S/C9H17NO5/c1-4(12)10-7-6(13)2-5(3-11)8(14)9(7)15/h5-9,11,13-15H,2-3H2,1H3,(H,10,12)/t5-,6+,7+,8+,9-/m1/s1 |
| InChIKey | RCLPQSKXNCAYRL-ZTKNNBQKSA-N |
| XLogP | -2.41 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |