C33H42N12O9 — CID 101009672
2,34,41-trinitro-4,10,13,17,20,23,26,32,35-nonazaheptacyclo[18.14.6.13,33.114,22.010,15.016,21.026,42]dotetraconta-1(34),2,14(42),15,21,33(41)-hexaene-12,18,24-trione (PubChem CID 101009672) has the molecular formula C33H42N12O9 and a molecular weight of 750.77 g/mol. Its IUPAC name is 2,34,41-trinitro-4,10,13,17,20,23,26,32,35-nonazaheptacyclo[18.14.6.13,33.114,22.010,15.016,21.026,42]dotetraconta-1(34),2,14(42),15,21,33(41)-hexaene-12,18,24-trione.
| Compound Name | 2,34,41-trinitro-4,10,13,17,20,23,26,32,35-nonazaheptacyclo[18.14.6.13,33.114,22.010,15.016,21.026,42]dotetraconta-1(34),2,14(42),15,21,33(41)-hexaene-12,18,24-trione |
|---|---|
| PubChem CID | 101009672 |
| Molecular Formula | C33H42N12O9 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 750.32 |
| IUPAC Name | 2,34,41-trinitro-4,10,13,17,20,23,26,32,35-nonazaheptacyclo[18.14.6.13,33.114,22.010,15.016,21.026,42]dotetraconta-1(34),2,14(42),15,21,33(41)-hexaene-12,18,24-trione |
| SMILES | O=C1CN2CCCCCNc3c([N+](=O)[O-])c4c([N+](=O)[O-])c(c3[N+](=O)[O-])NCCCCCN3CC(=O)Nc5c2c(c2c(c53)NC(=O)CN2CCCCCN4)N1 |
| InChI | InChI=1S/C33H42N12O9/c46-19-16-40-13-7-1-4-10-34-22-31(43(49)50)23-33(45(53)54)24(32(22)44(51)52)36-12-6-3-9-15-42-18-21(48)39-27-29(42)25(37-19)28(40)26-30(27)41(17-20(47)38-26)14-8-2-5-11-35-23/h34-36H,1-18H2,(H,37,46)(H,38,47)(H,39,48) |
| InChIKey | ZKGBMOSQHMFGRC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 262.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|