C20H37NO3Si — CID 101010066
2-[(1S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4,4-dimethyl-2-oxocyclohexyl]-2-hydroxyacetonitrile (PubChem CID 101010066) has the molecular formula C20H37NO3Si and a molecular weight of 367.61 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4,4-dimethyl-2-oxocyclohexyl]-2-hydroxyacetonitrile.
| Compound Name | 2-[(1S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4,4-dimethyl-2-oxocyclohexyl]-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 101010066 |
| Molecular Formula | C20H37NO3Si |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-[(1S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4,4-dimethyl-2-oxocyclohexyl]-2-hydroxyacetonitrile |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)[C@H](C(O)C#N)CCC1(C)C |
| InChI | InChI=1S/C20H37NO3Si/c1-13(2)18(24-25(8,9)19(3,4)5)16-17(23)14(15(22)12-21)10-11-20(16,6)7/h13-16,18,22H,10-11H2,1-9H3/t14-,15?,16-,18+/m0/s1 |
| InChIKey | IPOYALNYSCWRCQ-LIBIOYMGSA-N |
| XLogP | 4.54 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|