About 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate
4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate (PubChem CID 101010205) has the molecular formula C21H30N2O7Si
and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate |
| PubChem CID | 101010205 |
| Molecular Formula | C21H30N2O7Si |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(O[Si](C)(C)C)(C(=O)OC)C(C)OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O7Si/c1-7-28-19(25)18(23-22)21(20(26)27-3,30-31(4,5)6)15(2)29-17(24)14-13-16-11-9-8-10-12-16/h8-12,15H,7,13-14H2,1-6H3 |
| InChIKey | AEPFCENFYQJSET-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 124.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate (CID 101010205) is 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate is CCOC(=O)C(=[N+]=[N-])C(O[Si](C)(C)C)(C(=O)OC)C(C)OC(=O)CCc1ccccc1.
What is the InChIKey of 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate?
The InChIKey is AEPFCENFYQJSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O7Si/c1-7-28-19(25)18(23-22)21(20(26)27-3,30-31(4,5)6)15(2)29-17(24)14-13-16-11-9-8-10-12-16/h8-12,15H,7,13-14H2,1-6H3.
What are the key properties of 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate?
4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate has a molecular weight of 450.56 g/mol, XLogP of 2.55, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl 3-diazo-2-[1-(3-phenylpropanoyloxy)ethyl]-2-trimethylsilyloxybutanedioate is sourced from PubChem (CID 101010205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).