C13H21NO2 — CID 101010248
(3R,7aS,11aR)-3-(hydroxymethyl)-1,2,3,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-5-one (PubChem CID 101010248) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (3R,7aS,11aR)-3-(hydroxymethyl)-1,2,3,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-5-one.
| Compound Name | (3R,7aS,11aR)-3-(hydroxymethyl)-1,2,3,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-5-one |
|---|---|
| PubChem CID | 101010248 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (3R,7aS,11aR)-3-(hydroxymethyl)-1,2,3,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-5-one |
| SMILES | O=C1CC[C@@H]2CCCC[C@@]23CC[C@H](CO)N13 |
| InChI | InChI=1S/C13H21NO2/c15-9-11-6-8-13-7-2-1-3-10(13)4-5-12(16)14(11)13/h10-11,15H,1-9H2/t10-,11+,13+/m0/s1 |
| InChIKey | KBJGSZSVNAROHK-DMDPSCGWSA-N |
| XLogP | 1.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |