C32H38N6O2 — CID 101010342
7,23-dimethyl-3,11,19,27,33,35-hexazapentacyclo[27.3.1.15,9.113,17.121,25]hexatriaconta-1(32),5(36),6,8,13,14,17(35),21,23,25(34),29(33),30-dodecaene-34,36-diol (PubChem CID 101010342) has the molecular formula C32H38N6O2 and a molecular weight of 538.70 g/mol. Its IUPAC name is 7,23-dimethyl-3,11,19,27,33,35-hexazapentacyclo[27.3.1.15,9.113,17.121,25]hexatriaconta-1(32),5(36),6,8,13,14,17(35),21,23,25(34),29(33),30-dodecaene-34,36-diol.
| Compound Name | 7,23-dimethyl-3,11,19,27,33,35-hexazapentacyclo[27.3.1.15,9.113,17.121,25]hexatriaconta-1(32),5(36),6,8,13,14,17(35),21,23,25(34),29(33),30-dodecaene-34,36-diol |
|---|---|
| PubChem CID | 101010342 |
| Molecular Formula | C32H38N6O2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 7,23-dimethyl-3,11,19,27,33,35-hexazapentacyclo[27.3.1.15,9.113,17.121,25]hexatriaconta-1(32),5(36),6,8,13,14,17(35),21,23,25(34),29(33),30-dodecaene-34,36-diol |
| SMILES | Cc1cc2c(O)c(c1)CNCc1cccc(n1)CNCc1cc(C)cc(c1O)CNCC1=NC(=C=CC1)CNC2 |
| InChI | InChI=1S/C32H38N6O2/c1-21-9-23-13-33-17-27-5-3-7-29(37-27)19-35-15-25-11-22(2)12-26(32(25)40)16-36-20-30-8-4-6-28(38-30)18-34-14-24(10-21)31(23)39/h3-5,7,9-12,33-36,39-40H,6,13-20H2,1-2H3 |
| InChIKey | YBHXJNHTVDFOCG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|