C41H51N3O6 — CID 10101092
6-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoylamino]propylamino]butyl]hexanamide (PubChem CID 10101092) has the molecular formula C41H51N3O6 and a molecular weight of 681.87 g/mol. Its IUPAC name is 6-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoylamino]propylamino]butyl]hexanamide.
| Compound Name | 6-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoylamino]propylamino]butyl]hexanamide |
|---|---|
| PubChem CID | 10101092 |
| Molecular Formula | C41H51N3O6 |
| Molecular Weight | 681.87 g/mol |
| Exact Mass | 681.38 |
| IUPAC Name | 6-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoylamino]propylamino]butyl]hexanamide |
| SMILES | CC1=C(CCCCCC(=O)NCCCCNCCCNC(=O)CCCCCC2=C(C)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C41H51N3O6/c1-28-30(40(49)34-20-11-9-18-32(34)38(28)47)16-5-3-7-22-36(45)43-26-14-13-24-42-25-15-27-44-37(46)23-8-4-6-17-31-29(2)39(48)33-19-10-12-21-35(33)41(31)50/h9-12,18-21,42H,3-8,13-17,22-27H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | JCXBGBYHJIAXJG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.87 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|