C26H42O20 — CID 101011423
1-O-[3-[(2R,3R)-4-[3-[(2R,3R)-2,3-dihydroxy-4-(3-methoxypropoxy)-4-oxobutanoyl]oxypropoxy]-2,3-dihydroxy-4-oxobutanoyl]oxypropyl] 4-O-(3-methoxypropyl) (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 101011423) has the molecular formula C26H42O20 and a molecular weight of 674.60 g/mol. Its IUPAC name is 1-O-[3-[(2R,3R)-4-[3-[(2R,3R)-2,3-dihydroxy-4-(3-methoxypropoxy)-4-oxobutanoyl]oxypropoxy]-2,3-dihydroxy-4-oxobutanoyl]oxypropyl] 4-O-(3-methoxypropyl) (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | 1-O-[3-[(2R,3R)-4-[3-[(2R,3R)-2,3-dihydroxy-4-(3-methoxypropoxy)-4-oxobutanoyl]oxypropoxy]-2,3-dihydroxy-4-oxobutanoyl]oxypropyl] 4-O-(3-methoxypropyl) (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 101011423 |
| Molecular Formula | C26H42O20 |
| Molecular Weight | 674.60 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | 1-O-[3-[(2R,3R)-4-[3-[(2R,3R)-2,3-dihydroxy-4-(3-methoxypropoxy)-4-oxobutanoyl]oxypropoxy]-2,3-dihydroxy-4-oxobutanoyl]oxypropyl] 4-O-(3-methoxypropyl) (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | COCCCOC(=O)[C@H](O)[C@@H](O)C(=O)OCCCOC(=O)[C@H](O)[C@@H](O)C(=O)OCCCOC(=O)[C@H](O)[C@@H](O)C(=O)OCCCOC |
| InChI | InChI=1S/C26H42O20/c1-39-7-3-9-41-21(33)15(27)17(29)23(35)43-11-5-13-45-25(37)19(31)20(32)26(38)46-14-6-12-44-24(36)18(30)16(28)22(34)42-10-4-8-40-2/h15-20,27-32H,3-14H2,1-2H3/t15-,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | LLVQIEPEPPTVFV-BZIXAJQCSA-N |
| XLogP | -4.74 |
| TPSA | 297.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.60 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|