C23H15N5O6 — CID 101011910
[1-(4-methoxyphenyl)-6,8-dinitro-[1,2,4]triazolo[3,4-a]isoindol-5-yl]-phenylmethanone (PubChem CID 101011910) has the molecular formula C23H15N5O6 and a molecular weight of 457.40 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-6,8-dinitro-[1,2,4]triazolo[3,4-a]isoindol-5-yl]-phenylmethanone.
| Compound Name | [1-(4-methoxyphenyl)-6,8-dinitro-[1,2,4]triazolo[3,4-a]isoindol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101011910 |
| Molecular Formula | C23H15N5O6 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [1-(4-methoxyphenyl)-6,8-dinitro-[1,2,4]triazolo[3,4-a]isoindol-5-yl]-phenylmethanone |
| SMILES | COc1ccc(-n2ncn3c(C(=O)c4ccccc4)c4c([N+](=O)[O-])cc([N+](=O)[O-])cc4c23)cc1 |
| InChI | InChI=1S/C23H15N5O6/c1-34-17-9-7-15(8-10-17)26-23-18-11-16(27(30)31)12-19(28(32)33)20(18)21(25(23)13-24-26)22(29)14-5-3-2-4-6-14/h2-13H,1H3 |
| InChIKey | FKERQJXYEWVCJW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 134.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|