C21H30O3Si — CID 101011976
(4aS,10S)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one (PubChem CID 101011976) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (4aS,10S)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one.
| Compound Name | (4aS,10S)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 101011976 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (4aS,10S)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one |
| SMILES | COc1cccc2c1C=C1C(=O)CCC[C@@H]1[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H30O3Si/c1-21(2,3)25(5,6)24-20-14-9-7-11-18(22)16(14)13-17-15(20)10-8-12-19(17)23-4/h8,10,12-14,20H,7,9,11H2,1-6H3/t14-,20-/m0/s1 |
| InChIKey | CIQXFZOSHMQXCU-XOBRGWDASA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|