C17H26O4 — CID 101012293
(9S)-9-hydroxy-6-octyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-4-one (PubChem CID 101012293) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (9S)-9-hydroxy-6-octyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-4-one.
| Compound Name | (9S)-9-hydroxy-6-octyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
|---|---|
| PubChem CID | 101012293 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (9S)-9-hydroxy-6-octyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
| SMILES | CCCCCCCCC12OC(=O)C3C4CC(C(O1)[C@H]4O)C32 |
| InChI | InChI=1S/C17H26O4/c1-2-3-4-5-6-7-8-17-13-11-9-10(12(13)16(19)21-17)14(18)15(11)20-17/h10-15,18H,2-9H2,1H3/t10?,11?,12?,13?,14-,15?,17?/m0/s1 |
| InChIKey | ZHEMNTROSGNNOC-IDQDBYOESA-N |
| XLogP | 2.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|