C18H22O6S — CID 101012295
[(4S,9S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 101012295) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is [(4S,9S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S,9S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101012295 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [(4S,9S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C3CC4C2OC2(C)OC(C)(O)C3C42)cc1 |
| InChI | InChI=1S/C18H22O6S/c1-9-4-6-10(7-5-9)25(20,21)23-16-11-8-12-14-13(11)17(2,19)24-18(14,3)22-15(12)16/h4-7,11-16,19H,8H2,1-3H3/t11?,12?,13?,14?,15?,16-,17?,18?/m0/s1 |
| InChIKey | UPLJZSGDYXHYNW-OLUJWQSMSA-N |
| XLogP | 1.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|