C24H34O6S — CID 101012296
[(4S,9S)-4,6-dibutyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 101012296) has the molecular formula C24H34O6S and a molecular weight of 450.60 g/mol. Its IUPAC name is [(4S,9S)-4,6-dibutyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S,9S)-4,6-dibutyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101012296 |
| Molecular Formula | C24H34O6S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [(4S,9S)-4,6-dibutyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCC1(O)OC2(CCCC)OC3C4CC(C1C42)[C@@H]3OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34O6S/c1-4-6-12-23(25)19-17-14-18-20(19)24(30-23,13-7-5-2)28-21(18)22(17)29-31(26,27)16-10-8-15(3)9-11-16/h8-11,17-22,25H,4-7,12-14H2,1-3H3/t17?,18?,19?,20?,21?,22-,23?,24?/m0/s1 |
| InChIKey | KBAJVNBCXSSZLR-GQJBIPQBSA-N |
| XLogP | 4.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|