C21H40O3Si — CID 101013086
ethyl (4E,7E)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,7-dienoate (PubChem CID 101013086) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is ethyl (4E,7E)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,7-dienoate.
| Compound Name | ethyl (4E,7E)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,7-dienoate |
|---|---|
| PubChem CID | 101013086 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | ethyl (4E,7E)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,7-dienoate |
| SMILES | CCOC(=O)CC(C)/C(C)=C/C/C=C(\C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-10-23-20(22)16-19(4)18(3)13-11-12-17(2)14-15-24-25(8,9)21(5,6)7/h12-13,19H,10-11,14-16H2,1-9H3/b17-12+,18-13+ |
| InChIKey | DZYFUNINQSLBLP-PWDIZTEBSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|