C27H26N2O7 — CID 101013122
dimethyl (1R,2S,3R,4R,5S,7R,8S,9S,10R,11S)-14,16-dimethoxy-6-oxa-13,15-diazaoctacyclo[9.6.6.13,9.02,10.04,8.05,7.012,17.018,23]tetracosa-12(17),13,15,18,20,22-hexaene-5,7-dicarboxylate (PubChem CID 101013122) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4R,5S,7R,8S,9S,10R,11S)-14,16-dimethoxy-6-oxa-13,15-diazaoctacyclo[9.6.6.13,9.02,10.04,8.05,7.012,17.018,23]tetracosa-12(17),13,15,18,20,22-hexaene-5,7-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4R,5S,7R,8S,9S,10R,11S)-14,16-dimethoxy-6-oxa-13,15-diazaoctacyclo[9.6.6.13,9.02,10.04,8.05,7.012,17.018,23]tetracosa-12(17),13,15,18,20,22-hexaene-5,7-dicarboxylate |
|---|---|
| PubChem CID | 101013122 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | dimethyl (1R,2S,3R,4R,5S,7R,8S,9S,10R,11S)-14,16-dimethoxy-6-oxa-13,15-diazaoctacyclo[9.6.6.13,9.02,10.04,8.05,7.012,17.018,23]tetracosa-12(17),13,15,18,20,22-hexaene-5,7-dicarboxylate |
| SMILES | COC(=O)[C@]12O[C@@]1(C(=O)OC)[C@@H]1[C@@H]3C[C@@H]([C@H]4[C@H]5c6ccccc6[C@H](c6c(OC)nc(OC)nc65)[C@@H]34)[C@@H]12 |
| InChI | InChI=1S/C27H26N2O7/c1-32-22-18-14-10-7-5-6-8-11(10)17(21(18)28-25(29-22)35-4)16-13-9-12(15(14)16)19-20(13)27(24(31)34-3)26(19,36-27)23(30)33-2/h5-8,12-17,19-20H,9H2,1-4H3/t12-,13+,14+,15-,16-,17-,19-,20+,26-,27+/m1/s1 |
| InChIKey | REFHQSBDHLOPOJ-UEQIWJQOSA-N |
| XLogP | 2.07 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|