C12H14N2O8 — CID 101013589
[(2R,3S,5R)-3-acetyloxy-5-(2,4,5-trioxoimidazolidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 101013589) has the molecular formula C12H14N2O8 and a molecular weight of 314.25 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-(2,4,5-trioxoimidazolidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-(2,4,5-trioxoimidazolidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101013589 |
| Molecular Formula | C12H14N2O8 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-(2,4,5-trioxoimidazolidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)NC(=O)C2=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H14N2O8/c1-5(15)20-4-8-7(21-6(2)16)3-9(22-8)14-11(18)10(17)13-12(14)19/h7-9H,3-4H2,1-2H3,(H,13,17,19)/t7-,8+,9+/m0/s1 |
| InChIKey | HDTGFLMUKPXFSL-DJLDLDEBSA-N |
| XLogP | -1.33 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|