C22H27N3O3 — CID 101013908
4-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 101013908) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | 4-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 101013908 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | CCC1=NO[C@@H](C(=O)N2C3CC4CCC3(C(=O)N2c2ccccc2)C4(C)C)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-4-15-13-17(28-23-15)19(26)25-18-12-14-10-11-22(18,21(14,2)3)20(27)24(25)16-8-6-5-7-9-16/h5-9,14,17-18H,4,10-13H2,1-3H3/t14?,17-,18?,22?/m1/s1 |
| InChIKey | KLDMPCZQTPMYBB-MNWXJWKNSA-N |
| XLogP | 3.53 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |