C47H25FN6S — CID 10101412
2-(4-fluorophenyl)-7,12,17-tris(2-pyridin-2-ylethynyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6,8(23),9,11,13(22),14,16,18-undecaene (PubChem CID 10101412) has the molecular formula C47H25FN6S and a molecular weight of 724.82 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7,12,17-tris(2-pyridin-2-ylethynyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6,8(23),9,11,13(22),14,16,18-undecaene.
| Compound Name | 2-(4-fluorophenyl)-7,12,17-tris(2-pyridin-2-ylethynyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6,8(23),9,11,13(22),14,16,18-undecaene |
|---|---|
| PubChem CID | 10101412 |
| Molecular Formula | C47H25FN6S |
| Molecular Weight | 724.82 g/mol |
| Exact Mass | 724.18 |
| IUPAC Name | 2-(4-fluorophenyl)-7,12,17-tris(2-pyridin-2-ylethynyl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6,8(23),9,11,13(22),14,16,18-undecaene |
| SMILES | Fc1ccc(-c2c3ccc([nH]3)c(C#Cc3ccccn3)c3nc(c(C#Cc4ccccn4)c4nc(c(C#Cc5ccccn5)c5ccc2s5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H25FN6S/c48-32-12-10-31(11-13-32)47-44-25-24-42(54-44)37(18-15-34-8-2-5-29-50-34)40-21-20-39(52-40)36(17-14-33-7-1-4-28-49-33)41-22-23-43(53-41)38(45-26-27-46(47)55-45)19-16-35-9-3-6-30-51-35/h1-13,20-30,54H/b39-36-,40-37-,41-36-,42-37-,43-38-,45-38-,47-44-,47-46- |
| InChIKey | VNOAKRQUCXMASY-UZRDCDLVSA-N |
| XLogP | 9.58 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.82 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|