C20H32 — CID 101014638
2,2,3,3,4,4,9,10,11-nonamethylbicyclo[5.3.1]undeca-1(10),7(11),8-triene (PubChem CID 101014638) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 2,2,3,3,4,4,9,10,11-nonamethylbicyclo[5.3.1]undeca-1(10),7(11),8-triene.
| Compound Name | 2,2,3,3,4,4,9,10,11-nonamethylbicyclo[5.3.1]undeca-1(10),7(11),8-triene |
|---|---|
| PubChem CID | 101014638 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2,2,3,3,4,4,9,10,11-nonamethylbicyclo[5.3.1]undeca-1(10),7(11),8-triene |
| SMILES | Cc1cc2c(C)c(c1C)C(C)(C)C(C)(C)C(C)(C)CC2 |
| InChI | InChI=1S/C20H32/c1-13-12-16-10-11-18(4,5)20(8,9)19(6,7)17(14(13)2)15(16)3/h12H,10-11H2,1-9H3 |
| InChIKey | JADWNNYFWPKWAI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |