C17H21NO7 — CID 101015475
(1R,2S,6R,7S,9R,12R)-4,4-dimethyl-7-(nitromethyl)-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 101015475) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is (1R,2S,6R,7S,9R,12R)-4,4-dimethyl-7-(nitromethyl)-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2S,6R,7S,9R,12R)-4,4-dimethyl-7-(nitromethyl)-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 101015475 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (1R,2S,6R,7S,9R,12R)-4,4-dimethyl-7-(nitromethyl)-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](C[N+](=O)[O-])O[C@@H]1CO[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C17H21NO7/c1-17(2)24-14-11(8-18(19)20)22-12-9-21-16(10-6-4-3-5-7-10)23-13(12)15(14)25-17/h3-7,11-16H,8-9H2,1-2H3/t11-,12+,13+,14+,15-,16+/m0/s1 |
| InChIKey | VTLPZYPIRGXXFQ-NHOPFSRNSA-N |
| XLogP | 1.66 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|