C21H21NO7 — CID 101015479
(1R,2R,4R,6R,7S,9R,12R)-7-(nitromethyl)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 101015479) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is (1R,2R,4R,6R,7S,9R,12R)-7-(nitromethyl)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2R,4R,6R,7S,9R,12R)-7-(nitromethyl)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 101015479 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (1R,2R,4R,6R,7S,9R,12R)-7-(nitromethyl)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | O=[N+]([O-])C[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2O[C@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C21H21NO7/c23-22(24)11-15-17-19(29-21(28-17)14-9-5-2-6-10-14)18-16(26-15)12-25-20(27-18)13-7-3-1-4-8-13/h1-10,15-21H,11-12H2/t15-,16+,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | BCHFCSJUDWHYQP-HOLKMYPKSA-N |
| XLogP | 2.63 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|