C29H46O6 — CID 101016440
dimethyl 3-[(2R)-2,6-dimethylheptyl]-5-(9-methoxy-9-oxononyl)benzene-1,2-dicarboxylate (PubChem CID 101016440) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is dimethyl 3-[(2R)-2,6-dimethylheptyl]-5-(9-methoxy-9-oxononyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[(2R)-2,6-dimethylheptyl]-5-(9-methoxy-9-oxononyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101016440 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | dimethyl 3-[(2R)-2,6-dimethylheptyl]-5-(9-methoxy-9-oxononyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)CCCCCCCCc1cc(C[C@H](C)CCCC(C)C)c(C(=O)OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C29H46O6/c1-21(2)14-13-15-22(3)18-24-19-23(16-11-9-7-8-10-12-17-26(30)33-4)20-25(28(31)34-5)27(24)29(32)35-6/h19-22H,7-18H2,1-6H3/t22-/m1/s1 |
| InChIKey | YFWDIGMAGYHPSX-JOCHJYFZSA-N |
| XLogP | 6.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|